CAS:72093-07-3|5-Chloro-2-methylpyridine
Molecular Formula:C6H6ClN
Molecular Weight:127.57 g/mol
Purity:98 percent
Package:100g/250g/500g/1kg/bulk package
- Penghantaran Seluruh Dunia
- Jaminan kualiti
- Perkhidmatan Pelanggan 24/7
pengenalan produk
5-Chloro-2-methylpyridine has been extensively studied for its potential applications in scientific research. It has been used as a catalyst in the synthesis of various organic compounds, including pharmaceuticals, polymers, and other materials. It has also been used as a reagent in the synthesis of various heterocyclic compounds. In addition, it has been used in the synthesis of various organometallic compounds and in the synthesis of various polymers-based materials.
|
|
|
| 5-chloro-2-methylpyridine | |
| MFCD04114188 | |
| 1.15g/cm3 | |
| 163ºC at 760 mmHg | |
| 62ºC | |
| 1.526 | |
| InChI=1S/C6H6ClN/c1-5-2-3-6(7)4-8-5/h2-4H,1H3 | |
| DEMKNLXJQNYAFY-UHFFFAOYSA-N |
Cool tags: cas:72093-07-3|5-chloro-2-methylpyridine, price, quotation, discount, in stock, for sale
![CAS:18741-85-0 | [1,1'-Binaphthalene]-2,2'-diamine](/uploads/202335855/small/cas-18741-85-0-1-1-binaphthalene-2-2-diaminea963a01f-c678-4c94-a64c-4adbe7f28552.jpg?size=384x0)
